C31H48NO6- — CID 176585130
4-(10,13-dimethyl-3-oxidoperoxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-N-[2-(2-prop-2-ynoxyethoxy)ethyl]pentanamide (PubChem CID 176585130) has the molecular formula C31H48NO6- and a molecular weight of 530.73 g/mol. Its IUPAC name is 4-(10,13-dimethyl-3-oxidoperoxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-N-[2-(2-prop-2-ynoxyethoxy)ethyl]pentanamide.
| Compound Name | 4-(10,13-dimethyl-3-oxidoperoxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-N-[2-(2-prop-2-ynoxyethoxy)ethyl]pentanamide |
|---|---|
| PubChem CID | 176585130 |
| Molecular Formula | C31H48NO6- |
| Molecular Weight | 530.73 g/mol |
| Exact Mass | 530.35 |
| IUPAC Name | 4-(10,13-dimethyl-3-oxidoperoxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-N-[2-(2-prop-2-ynoxyethoxy)ethyl]pentanamide |
| SMILES | C#CCOCCOCCNC(=O)CCC(C)C1CCC2C3CC=C4CC(OO[O-])CCC4(C)C3CCC12C |
| InChI | InChI=1S/C31H49NO6/c1-5-17-35-19-20-36-18-16-32-29(33)11-6-22(2)26-9-10-27-25-8-7-23-21-24(37-38-34)12-14-30(23,3)28(25)13-15-31(26,27)4/h1,7,22,24-28,34H,6,8-21H2,2-4H3,(H,32,33)/p-1 |
| InChIKey | DRCGQWKIFNJXSW-UHFFFAOYSA-M |
| XLogP | 4.36 |
| TPSA | 89.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.73 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|