C35H56NO8- — CID 176585128
4-(10,13-dimethyl-3-oxidoperoxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-N-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]pentanamide (PubChem CID 176585128) has the molecular formula C35H56NO8- and a molecular weight of 618.83 g/mol. Its IUPAC name is 4-(10,13-dimethyl-3-oxidoperoxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-N-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]pentanamide.
| Compound Name | 4-(10,13-dimethyl-3-oxidoperoxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-N-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]pentanamide |
|---|---|
| PubChem CID | 176585128 |
| Molecular Formula | C35H56NO8- |
| Molecular Weight | 618.83 g/mol |
| Exact Mass | 618.40 |
| IUPAC Name | 4-(10,13-dimethyl-3-oxidoperoxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-N-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]pentanamide |
| SMILES | C#CCOCCOCCOCCOCCNC(=O)CCC(C)C1CCC2C3CC=C4CC(OO[O-])CCC4(C)C3CCC12C |
| InChI | InChI=1S/C35H57NO8/c1-5-17-39-19-21-41-23-24-42-22-20-40-18-16-36-33(37)11-6-26(2)30-9-10-31-29-8-7-27-25-28(43-44-38)12-14-34(27,3)32(29)13-15-35(30,31)4/h1,7,26,28-32,38H,6,8-25H2,2-4H3,(H,36,37)/p-1 |
| InChIKey | FHQVOUFPRGZTIL-UHFFFAOYSA-M |
| XLogP | 4.39 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.83 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|