C54H84O24 — CID 176585526
[(2S,3R,5S,6R)-2,3,4,5,6-pentakis[[2-(2,4-dimethyl-1,3-dioxan-2-yl)acetyl]oxy]cyclohexyl] 2-(2,6-dimethyl-1,4-dioxan-2-yl)acetate (PubChem CID 176585526) has the molecular formula C54H84O24 and a molecular weight of 1117.24 g/mol. Its IUPAC name is [(2S,3R,5S,6R)-2,3,4,5,6-pentakis[[2-(2,4-dimethyl-1,3-dioxan-2-yl)acetyl]oxy]cyclohexyl] 2-(2,6-dimethyl-1,4-dioxan-2-yl)acetate.
| Compound Name | [(2S,3R,5S,6R)-2,3,4,5,6-pentakis[[2-(2,4-dimethyl-1,3-dioxan-2-yl)acetyl]oxy]cyclohexyl] 2-(2,6-dimethyl-1,4-dioxan-2-yl)acetate |
|---|---|
| PubChem CID | 176585526 |
| Molecular Formula | C54H84O24 |
| Molecular Weight | 1117.24 g/mol |
| Exact Mass | 1116.54 |
| IUPAC Name | [(2S,3R,5S,6R)-2,3,4,5,6-pentakis[[2-(2,4-dimethyl-1,3-dioxan-2-yl)acetyl]oxy]cyclohexyl] 2-(2,6-dimethyl-1,4-dioxan-2-yl)acetate |
| SMILES | CC1COCC(C)(CC(=O)OC2C(OC(=O)CC3(C)OCCC(C)O3)[C@@H](OC(=O)CC3(C)OCCC(C)O3)C(OC(=O)CC3(C)OCCC(C)O3)[C@@H](OC(=O)CC3(C)OCCC(C)O3)[C@@H]2OC(=O)CC2(C)OCCC(C)O2)O1 |
| InChI | InChI=1S/C54H84O24/c1-31-13-18-62-50(8,74-31)24-38(56)68-44-43(67-37(55)23-49(7)30-61-29-36(6)73-49)45(69-39(57)25-51(9)63-19-14-32(2)75-51)47(71-41(59)27-53(11)65-21-16-34(4)77-53)48(72-42(60)28-54(12)66-22-17-35(5)78-54)46(44)70-40(58)26-52(10)64-20-15-33(3)76-52/h31-36,43-48H,13-30H2,1-12H3/t31?,32?,33?,34?,35?,36?,43?,44-,45?,46+,47-,48?,49?,50?,51?,52?,53?,54?/m1/s1 |
| InChIKey | XFOQZYUOGCDXNY-CDCSPUPWSA-N |
| XLogP | 4.71 |
| TPSA | 268.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1117.24 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|