C15H28Br2O4 — CID 158430543
5,5-bis(bromomethyl)-2,2-dimethyl-1,3-dioxane;2,2,4-trimethyl-1,3-dioxane (PubChem CID 158430543) has the molecular formula C15H28Br2O4 and a molecular weight of 432.19 g/mol. Its IUPAC name is 5,5-bis(bromomethyl)-2,2-dimethyl-1,3-dioxane;2,2,4-trimethyl-1,3-dioxane.
| Compound Name | 5,5-bis(bromomethyl)-2,2-dimethyl-1,3-dioxane;2,2,4-trimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 158430543 |
| Molecular Formula | C15H28Br2O4 |
| Molecular Weight | 432.19 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | 5,5-bis(bromomethyl)-2,2-dimethyl-1,3-dioxane;2,2,4-trimethyl-1,3-dioxane |
| SMILES | CC1(C)OCC(CBr)(CBr)CO1.CC1CCOC(C)(C)O1 |
| InChI | InChI=1S/C8H14Br2O2.C7H14O2/c1-7(2)11-5-8(3-9,4-10)6-12-7;1-6-4-5-8-7(2,3)9-6/h3-6H2,1-2H3;6H,4-5H2,1-3H3 |
| InChIKey | HBPJBPNIABZBGP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.19 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|