C9H18O2S — CID 88694763
(4-methyl-2-propan-2-yl-1,3-dioxan-2-yl)methanethiol (PubChem CID 88694763) has the molecular formula C9H18O2S and a molecular weight of 190.31 g/mol. Its IUPAC name is (4-methyl-2-propan-2-yl-1,3-dioxan-2-yl)methanethiol.
| Compound Name | (4-methyl-2-propan-2-yl-1,3-dioxan-2-yl)methanethiol |
|---|---|
| PubChem CID | 88694763 |
| Molecular Formula | C9H18O2S |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | (4-methyl-2-propan-2-yl-1,3-dioxan-2-yl)methanethiol |
| SMILES | CC1CCOC(CS)(C(C)C)O1 |
| InChI | InChI=1S/C9H18O2S/c1-7(2)9(6-12)10-5-4-8(3)11-9/h7-8,12H,4-6H2,1-3H3 |
| InChIKey | HBCVKRYDZBFAEA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|