C7H13ClO2 — CID 55303360
(2R,4S)-2-(chloromethyl)-2,4-dimethyl-1,3-dioxane (PubChem CID 55303360) has the molecular formula C7H13ClO2 and a molecular weight of 164.63 g/mol. Its IUPAC name is (2R,4S)-2-(chloromethyl)-2,4-dimethyl-1,3-dioxane.
| Compound Name | (2R,4S)-2-(chloromethyl)-2,4-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 55303360 |
| Molecular Formula | C7H13ClO2 |
| Molecular Weight | 164.63 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | (2R,4S)-2-(chloromethyl)-2,4-dimethyl-1,3-dioxane |
| SMILES | C[C@H]1CCO[C@@](C)(CCl)O1 |
| InChI | InChI=1S/C7H13ClO2/c1-6-3-4-9-7(2,5-8)10-6/h6H,3-5H2,1-2H3/t6-,7+/m0/s1 |
| InChIKey | JFJXOTPDJMSZNT-NKWVEPMBSA-N |
| XLogP | 1.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.63 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|