C16H16F3N3O2 — CID 176586220
1-[[3-(isocyanomethoxy)phenyl]methyl]-3-[3-(trifluoromethyl)-1-bicyclo[1.1.1]pentanyl]urea (PubChem CID 176586220) has the molecular formula C16H16F3N3O2 and a molecular weight of 339.32 g/mol. Its IUPAC name is 1-[[3-(isocyanomethoxy)phenyl]methyl]-3-[3-(trifluoromethyl)-1-bicyclo[1.1.1]pentanyl]urea.
| Compound Name | 1-[[3-(isocyanomethoxy)phenyl]methyl]-3-[3-(trifluoromethyl)-1-bicyclo[1.1.1]pentanyl]urea |
|---|---|
| PubChem CID | 176586220 |
| Molecular Formula | C16H16F3N3O2 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 1-[[3-(isocyanomethoxy)phenyl]methyl]-3-[3-(trifluoromethyl)-1-bicyclo[1.1.1]pentanyl]urea |
| SMILES | [C-]#[N+]COc1cccc(CNC(=O)NC23CC(C(F)(F)F)(C2)C3)c1 |
| InChI | InChI=1S/C16H16F3N3O2/c1-20-10-24-12-4-2-3-11(5-12)6-21-13(23)22-15-7-14(8-15,9-15)16(17,18)19/h2-5H,6-10H2,(H2,21,22,23) |
| InChIKey | NUOMHEIDSCTHCH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 54.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|