C8H15N2+ — CID 176586531
dimethyl-[(2E,4E)-5-(methylamino)penta-2,4-dienylidene]azanium (PubChem CID 176586531) has the molecular formula C8H15N2+ and a molecular weight of 139.22 g/mol. Its IUPAC name is dimethyl-[(2E,4E)-5-(methylamino)penta-2,4-dienylidene]azanium.
| Compound Name | dimethyl-[(2E,4E)-5-(methylamino)penta-2,4-dienylidene]azanium |
|---|---|
| PubChem CID | 176586531 |
| Molecular Formula | C8H15N2+ |
| Molecular Weight | 139.22 g/mol |
| Exact Mass | 139.12 |
| IUPAC Name | dimethyl-[(2E,4E)-5-(methylamino)penta-2,4-dienylidene]azanium |
| SMILES | CN/C=C/C=C/C=[N+](C)C |
| InChI | InChI=1S/C8H14N2/c1-9-7-5-4-6-8-10(2)3/h4-8H,1-3H3/p+1 |
| InChIKey | IAADFEXBGYZKQF-UHFFFAOYSA-O |
| XLogP | 0.62 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.22 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|