C17H11BNO — CID 176588776
CID 176588776 (PubChem CID 176588776) has the molecular formula C17H11BNO and a molecular weight of 256.09 g/mol.
| Compound Name | CID 176588776 |
|---|---|
| PubChem CID | 176588776 |
| Molecular Formula | C17H11BNO |
| Molecular Weight | 256.09 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | — |
| SMILES | [B](c1ccccc1)c1cccc2oc3cccnc3c12 |
| InChI | InChI=1S/C17H11BNO/c1-2-6-12(7-3-1)18-13-8-4-9-14-16(13)17-15(20-14)10-5-11-19-17/h1-11H |
| InChIKey | LBCPMYDVAQCZIT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.09 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|