C42H36BN3 — CID 176590015
15-tert-butyl-19-phenyl-6-(2,4,6-trimethylphenyl)-2,12,19-triaza-1-boraheptacyclo[12.11.1.12,9.03,8.018,26.020,25.013,27]heptacosa-3(8),4,6,9(27),10,12,14,16,18(26),20,22,24-dodecaene (PubChem CID 176590015) has the molecular formula C42H36BN3 and a molecular weight of 593.58 g/mol. Its IUPAC name is 15-tert-butyl-19-phenyl-6-(2,4,6-trimethylphenyl)-2,12,19-triaza-1-boraheptacyclo[12.11.1.12,9.03,8.018,26.020,25.013,27]heptacosa-3(8),4,6,9(27),10,12,14,16,18(26),20,22,24-dodecaene.
| Compound Name | 15-tert-butyl-19-phenyl-6-(2,4,6-trimethylphenyl)-2,12,19-triaza-1-boraheptacyclo[12.11.1.12,9.03,8.018,26.020,25.013,27]heptacosa-3(8),4,6,9(27),10,12,14,16,18(26),20,22,24-dodecaene |
|---|---|
| PubChem CID | 176590015 |
| Molecular Formula | C42H36BN3 |
| Molecular Weight | 593.58 g/mol |
| Exact Mass | 593.30 |
| IUPAC Name | 15-tert-butyl-19-phenyl-6-(2,4,6-trimethylphenyl)-2,12,19-triaza-1-boraheptacyclo[12.11.1.12,9.03,8.018,26.020,25.013,27]heptacosa-3(8),4,6,9(27),10,12,14,16,18(26),20,22,24-dodecaene |
| SMILES | Cc1cc(C)c(-c2ccc3c(c2)c2ccnc4c2n3B2c3ccccc3N(c3ccccc3)c3ccc(C(C)(C)C)c-4c32)c(C)c1 |
| InChI | InChI=1S/C42H36BN3/c1-25-22-26(2)37(27(3)23-25)28-16-18-34-31(24-28)30-20-21-44-40-38-32(42(4,5)6)17-19-36-39(38)43(46(34)41(30)40)33-14-10-11-15-35(33)45(36)29-12-8-7-9-13-29/h7-24H,1-6H3 |
| InChIKey | QODPLHKDPCECNW-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.58 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|