C36H30Cl2F3N9O2 — CID 176591428
[[9-[[5-[(3R)-3-amino-3-(6-chloro-2-pyridinyl)piperidin-1-yl]-2-(2,4,5-trifluorophenyl)-4-pyridinyl]methyl]purin-6-yl]amino]methyl 2-(2-chlorophenyl)acetate (PubChem CID 176591428) has the molecular formula C36H30Cl2F3N9O2 and a molecular weight of 748.60 g/mol. Its IUPAC name is [[9-[[5-[(3R)-3-amino-3-(6-chloro-2-pyridinyl)piperidin-1-yl]-2-(2,4,5-trifluorophenyl)-4-pyridinyl]methyl]purin-6-yl]amino]methyl 2-(2-chlorophenyl)acetate.
| Compound Name | [[9-[[5-[(3R)-3-amino-3-(6-chloro-2-pyridinyl)piperidin-1-yl]-2-(2,4,5-trifluorophenyl)-4-pyridinyl]methyl]purin-6-yl]amino]methyl 2-(2-chlorophenyl)acetate |
|---|---|
| PubChem CID | 176591428 |
| Molecular Formula | C36H30Cl2F3N9O2 |
| Molecular Weight | 748.60 g/mol |
| Exact Mass | 747.19 |
| IUPAC Name | [[9-[[5-[(3R)-3-amino-3-(6-chloro-2-pyridinyl)piperidin-1-yl]-2-(2,4,5-trifluorophenyl)-4-pyridinyl]methyl]purin-6-yl]amino]methyl 2-(2-chlorophenyl)acetate |
| SMILES | N[C@]1(c2cccc(Cl)n2)CCCN(c2cnc(-c3cc(F)c(F)cc3F)cc2Cn2cnc3c(NCOC(=O)Cc4ccccc4Cl)ncnc32)C1 |
| InChI | InChI=1S/C36H30Cl2F3N9O2/c37-24-6-2-1-5-21(24)12-32(51)52-20-47-34-33-35(45-18-44-34)50(19-46-33)16-22-11-28(23-13-26(40)27(41)14-25(23)39)43-15-29(22)49-10-4-9-36(42,17-49)30-7-3-8-31(38)48-30/h1-3,5-8,11,13-15,18-19H,4,9-10,12,16-17,20,42H2,(H,44,45,47)/t36-/m1/s1 |
| InChIKey | SABXBIOHMHQCRP-PSXMRANNSA-N |
| XLogP | 6.67 |
| TPSA | 136.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.60 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|