C48H47NO — CID 176595878
N-(1',2',3',5',6',7',8'-heptadeuteriospiro[adamantane-2,9'-fluorene]-4'-yl)-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)dibenzofuran-2-amine (PubChem CID 176595878) has the molecular formula C48H47NO and a molecular weight of 660.95 g/mol. Its IUPAC name is N-(1',2',3',5',6',7',8'-heptadeuteriospiro[adamantane-2,9'-fluorene]-4'-yl)-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)dibenzofuran-2-amine.
| Compound Name | N-(1',2',3',5',6',7',8'-heptadeuteriospiro[adamantane-2,9'-fluorene]-4'-yl)-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)dibenzofuran-2-amine |
|---|---|
| PubChem CID | 176595878 |
| Molecular Formula | C48H47NO |
| Molecular Weight | 660.95 g/mol |
| Exact Mass | 660.41 |
| IUPAC Name | N-(1',2',3',5',6',7',8'-heptadeuteriospiro[adamantane-2,9'-fluorene]-4'-yl)-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)dibenzofuran-2-amine |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])-c1c(N(c3ccc4c(c3)C(C)(C)CCC4(C)C)c3ccc4oc5ccccc5c4c3)c([2H])c([2H])c([2H])c1C21C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C48H47NO/c1-46(2)20-21-47(3,4)41-28-34(16-18-39(41)46)49(33-17-19-44-37(27-33)35-10-6-8-15-43(35)50-44)42-14-9-13-40-45(42)36-11-5-7-12-38(36)48(40)31-23-29-22-30(25-31)26-32(48)24-29/h5-19,27-32H,20-26H2,1-4H3/i5D,7D,9D,11D,12D,13D,14D |
| InChIKey | GOWORHBYDPRLLO-RHMJTLMSSA-N |
| XLogP | 13.13 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.95 |
| LogP ≤ 5 | 13.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |