About 7-propan-2-yl-3λ6-thia-7-azabicyclo[3.3.1]nonane 3,3-dioxide
7-propan-2-yl-3λ6-thia-7-azabicyclo[3.3.1]nonane 3,3-dioxide (PubChem CID 176597021) has the molecular formula C10H19NO2S
and a molecular weight of 217.33 g/mol. Its IUPAC name is 7-propan-2-yl-3λ6-thia-7-azabicyclo[3.3.1]nonane 3,3-dioxide.
Analyze 7-propan-2-yl-3λ6-thia-7-azabicyclo[3.3.1]nonane 3,3-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-propan-2-yl-3λ6-thia-7-azabicyclo[3.3.1]nonane 3,3-dioxide?
The IUPAC name of 7-propan-2-yl-3λ6-thia-7-azabicyclo[3.3.1]nonane 3,3-dioxide (CID 176597021) is 7-propan-2-yl-3λ6-thia-7-azabicyclo[3.3.1]nonane 3,3-dioxide.
What is the SMILES notation for 7-propan-2-yl-3λ6-thia-7-azabicyclo[3.3.1]nonane 3,3-dioxide?
The canonical SMILES for 7-propan-2-yl-3λ6-thia-7-azabicyclo[3.3.1]nonane 3,3-dioxide is CC(C)N1CC2CC(C1)CS(=O)(=O)C2.
What is the InChIKey of 7-propan-2-yl-3λ6-thia-7-azabicyclo[3.3.1]nonane 3,3-dioxide?
The InChIKey is YSEZJUBSASVHTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2S/c1-8(2)11-4-9-3-10(5-11)7-14(12,13)6-9/h8-10H,3-7H2,1-2H3.
What are the key properties of 7-propan-2-yl-3λ6-thia-7-azabicyclo[3.3.1]nonane 3,3-dioxide?
7-propan-2-yl-3λ6-thia-7-azabicyclo[3.3.1]nonane 3,3-dioxide has a molecular weight of 217.33 g/mol, XLogP of 0.76, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-propan-2-yl-3λ6-thia-7-azabicyclo[3.3.1]nonane 3,3-dioxide is sourced from PubChem (CID 176597021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).