C10H10F2INO — CID 176598517
1-(2,6-difluoro-4-iodo-3-pyridinyl)-3-methylbutan-1-one (PubChem CID 176598517) has the molecular formula C10H10F2INO and a molecular weight of 325.10 g/mol. Its IUPAC name is 1-(2,6-difluoro-4-iodo-3-pyridinyl)-3-methylbutan-1-one.
| Compound Name | 1-(2,6-difluoro-4-iodo-3-pyridinyl)-3-methylbutan-1-one |
|---|---|
| PubChem CID | 176598517 |
| Molecular Formula | C10H10F2INO |
| Molecular Weight | 325.10 g/mol |
| Exact Mass | 324.98 |
| IUPAC Name | 1-(2,6-difluoro-4-iodo-3-pyridinyl)-3-methylbutan-1-one |
| SMILES | CC(C)CC(=O)c1c(I)cc(F)nc1F |
| InChI | InChI=1S/C10H10F2INO/c1-5(2)3-7(15)9-6(13)4-8(11)14-10(9)12/h4-5H,3H2,1-2H3 |
| InChIKey | DHLBRIVPPLEIKF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.10 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|