About 7-ethylnonyl 8-[2-hydroxyethyl-(8-nonoxy-8-oxooctyl)amino]-2-methyloctanoate
7-ethylnonyl 8-[2-hydroxyethyl-(8-nonoxy-8-oxooctyl)amino]-2-methyloctanoate (PubChem CID 176602496) has the molecular formula C39H77NO5
and a molecular weight of 640.05 g/mol. Its IUPAC name is 7-ethylnonyl 8-[2-hydroxyethyl-(8-nonoxy-8-oxooctyl)amino]-2-methyloctanoate.
Molecular Properties
| Compound Name | 7-ethylnonyl 8-[2-hydroxyethyl-(8-nonoxy-8-oxooctyl)amino]-2-methyloctanoate |
| PubChem CID | 176602496 |
| Molecular Formula | C39H77NO5 |
| Molecular Weight | 640.05 g/mol |
| Exact Mass | 639.58 |
| IUPAC Name | 7-ethylnonyl 8-[2-hydroxyethyl-(8-nonoxy-8-oxooctyl)amino]-2-methyloctanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCO)CCCCCCC(C)C(=O)OCCCCCCC(CC)CC |
| InChI | InChI=1S/C39H77NO5/c1-5-8-9-10-11-18-25-34-44-38(42)29-22-13-12-16-23-30-40(32-33-41)31-24-17-14-20-27-36(4)39(43)45-35-26-19-15-21-28-37(6-2)7-3/h36-37,41H,5-35H2,1-4H3 |
| InChIKey | VNUVFHKWPIGKTJ-UHFFFAOYSA-N |
| XLogP | 10.43 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 640.05 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-ethylnonyl 8-[2-hydroxyethyl-(8-nonoxy-8-oxooctyl)amino]-2-methyloctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethylnonyl 8-[2-hydroxyethyl-(8-nonoxy-8-oxooctyl)amino]-2-methyloctanoate?
The IUPAC name of 7-ethylnonyl 8-[2-hydroxyethyl-(8-nonoxy-8-oxooctyl)amino]-2-methyloctanoate (CID 176602496) is 7-ethylnonyl 8-[2-hydroxyethyl-(8-nonoxy-8-oxooctyl)amino]-2-methyloctanoate.
What is the SMILES notation for 7-ethylnonyl 8-[2-hydroxyethyl-(8-nonoxy-8-oxooctyl)amino]-2-methyloctanoate?
The canonical SMILES for 7-ethylnonyl 8-[2-hydroxyethyl-(8-nonoxy-8-oxooctyl)amino]-2-methyloctanoate is CCCCCCCCCOC(=O)CCCCCCCN(CCO)CCCCCCC(C)C(=O)OCCCCCCC(CC)CC.
What is the InChIKey of 7-ethylnonyl 8-[2-hydroxyethyl-(8-nonoxy-8-oxooctyl)amino]-2-methyloctanoate?
The InChIKey is VNUVFHKWPIGKTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H77NO5/c1-5-8-9-10-11-18-25-34-44-38(42)29-22-13-12-16-23-30-40(32-33-41)31-24-17-14-20-27-36(4)39(43)45-35-26-19-15-21-28-37(6-2)7-3/h36-37,41H,5-35H2,1-4H3.
What are the key properties of 7-ethylnonyl 8-[2-hydroxyethyl-(8-nonoxy-8-oxooctyl)amino]-2-methyloctanoate?
7-ethylnonyl 8-[2-hydroxyethyl-(8-nonoxy-8-oxooctyl)amino]-2-methyloctanoate has a molecular weight of 640.05 g/mol, XLogP of 10.43, 35 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethylnonyl 8-[2-hydroxyethyl-(8-nonoxy-8-oxooctyl)amino]-2-methyloctanoate is sourced from PubChem (CID 176602496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).