C44H89NO7 — CID 176570935
formic acid;7-[2-hydroxyethyl(8-octylhexadecyl)amino]heptyl 2-methyloctanoate (PubChem CID 176570935) has the molecular formula C44H89NO7 and a molecular weight of 744.20 g/mol. Its IUPAC name is formic acid;7-[2-hydroxyethyl(8-octylhexadecyl)amino]heptyl 2-methyloctanoate.
| Compound Name | formic acid;7-[2-hydroxyethyl(8-octylhexadecyl)amino]heptyl 2-methyloctanoate |
|---|---|
| PubChem CID | 176570935 |
| Molecular Formula | C44H89NO7 |
| Molecular Weight | 744.20 g/mol |
| Exact Mass | 743.66 |
| IUPAC Name | formic acid;7-[2-hydroxyethyl(8-octylhexadecyl)amino]heptyl 2-methyloctanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)CCCCCCCN(CCO)CCCCCCCOC(=O)C(C)CCCCCC.O=CO.O=CO |
| InChI | InChI=1S/C42H85NO3.2CH2O2/c1-5-8-11-14-18-25-32-41(33-26-19-15-12-9-6-2)34-27-20-16-21-28-35-43(37-38-44)36-29-22-17-23-30-39-46-42(45)40(4)31-24-13-10-7-3;2*2-1-3/h40-41,44H,5-39H2,1-4H3;2*1H,(H,2,3) |
| InChIKey | CFZFUPPHXIVAFJ-UHFFFAOYSA-N |
| XLogP | 12.24 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.20 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|