C16H26OS — CID 176603006
2-(cyclohexylidenemethoxymethyl)-2-ethyl-7-thiabicyclo[2.2.1]heptane (PubChem CID 176603006) has the molecular formula C16H26OS and a molecular weight of 266.45 g/mol. Its IUPAC name is 2-(cyclohexylidenemethoxymethyl)-2-ethyl-7-thiabicyclo[2.2.1]heptane.
| Compound Name | 2-(cyclohexylidenemethoxymethyl)-2-ethyl-7-thiabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 176603006 |
| Molecular Formula | C16H26OS |
| Molecular Weight | 266.45 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 2-(cyclohexylidenemethoxymethyl)-2-ethyl-7-thiabicyclo[2.2.1]heptane |
| SMILES | CCC1(COC=C2CCCCC2)CC2CCC1S2 |
| InChI | InChI=1S/C16H26OS/c1-2-16(10-14-8-9-15(16)18-14)12-17-11-13-6-4-3-5-7-13/h11,14-15H,2-10,12H2,1H3 |
| InChIKey | KADNPUUJGRSJAC-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|