C15H24OS — CID 176603367
2-(cyclohexylidenemethoxymethyl)-2-methyl-7-thiabicyclo[2.2.1]heptane (PubChem CID 176603367) has the molecular formula C15H24OS and a molecular weight of 252.42 g/mol. Its IUPAC name is 2-(cyclohexylidenemethoxymethyl)-2-methyl-7-thiabicyclo[2.2.1]heptane.
| Compound Name | 2-(cyclohexylidenemethoxymethyl)-2-methyl-7-thiabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 176603367 |
| Molecular Formula | C15H24OS |
| Molecular Weight | 252.42 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 2-(cyclohexylidenemethoxymethyl)-2-methyl-7-thiabicyclo[2.2.1]heptane |
| SMILES | CC1(COC=C2CCCCC2)CC2CCC1S2 |
| InChI | InChI=1S/C15H24OS/c1-15(9-13-7-8-14(15)17-13)11-16-10-12-5-3-2-4-6-12/h10,13-14H,2-9,11H2,1H3 |
| InChIKey | AHNDFGJWXOTYMR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|