C14H22OS — CID 176603511
2-(cyclopentylidenemethoxymethyl)-2-methyl-7-thiabicyclo[2.2.1]heptane (PubChem CID 176603511) has the molecular formula C14H22OS and a molecular weight of 238.40 g/mol. Its IUPAC name is 2-(cyclopentylidenemethoxymethyl)-2-methyl-7-thiabicyclo[2.2.1]heptane.
| Compound Name | 2-(cyclopentylidenemethoxymethyl)-2-methyl-7-thiabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 176603511 |
| Molecular Formula | C14H22OS |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 2-(cyclopentylidenemethoxymethyl)-2-methyl-7-thiabicyclo[2.2.1]heptane |
| SMILES | CC1(COC=C2CCCC2)CC2CCC1S2 |
| InChI | InChI=1S/C14H22OS/c1-14(8-12-6-7-13(14)16-12)10-15-9-11-4-2-3-5-11/h9,12-13H,2-8,10H2,1H3 |
| InChIKey | MQHQZUFWOVHGOC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|