About 2-(1-ethenoxyethyl)oxane
2-(1-ethenoxyethyl)oxane (PubChem CID 176603221) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is 2-(1-ethenoxyethyl)oxane.
Molecular Properties
| Compound Name | 2-(1-ethenoxyethyl)oxane |
| PubChem CID | 176603221 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 2-(1-ethenoxyethyl)oxane |
| SMILES | C=COC(C)C1CCCCO1 |
| InChI | InChI=1S/C9H16O2/c1-3-10-8(2)9-6-4-5-7-11-9/h3,8-9H,1,4-7H2,2H3 |
| InChIKey | SUWCQDFLVCDMFR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-ethenoxyethyl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-ethenoxyethyl)oxane?
The IUPAC name of 2-(1-ethenoxyethyl)oxane (CID 176603221) is 2-(1-ethenoxyethyl)oxane.
What is the SMILES notation for 2-(1-ethenoxyethyl)oxane?
The canonical SMILES for 2-(1-ethenoxyethyl)oxane is C=COC(C)C1CCCCO1.
What is the InChIKey of 2-(1-ethenoxyethyl)oxane?
The InChIKey is SUWCQDFLVCDMFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2/c1-3-10-8(2)9-6-4-5-7-11-9/h3,8-9H,1,4-7H2,2H3.
What are the key properties of 2-(1-ethenoxyethyl)oxane?
2-(1-ethenoxyethyl)oxane has a molecular weight of 156.22 g/mol, XLogP of 2.10, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-ethenoxyethyl)oxane is sourced from PubChem (CID 176603221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).