C25H29F4O5S- — CID 176604017
2,3,5,6-tetrafluoro-4-(2,4,6-tritert-butylbenzoyl)oxybenzenesulfonate (PubChem CID 176604017) has the molecular formula C25H29F4O5S- and a molecular weight of 517.56 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-(2,4,6-tritert-butylbenzoyl)oxybenzenesulfonate.
| Compound Name | 2,3,5,6-tetrafluoro-4-(2,4,6-tritert-butylbenzoyl)oxybenzenesulfonate |
|---|---|
| PubChem CID | 176604017 |
| Molecular Formula | C25H29F4O5S- |
| Molecular Weight | 517.56 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-(2,4,6-tritert-butylbenzoyl)oxybenzenesulfonate |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(C(=O)Oc2c(F)c(F)c(S(=O)(=O)[O-])c(F)c2F)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H30F4O5S/c1-23(2,3)12-10-13(24(4,5)6)15(14(11-12)25(7,8)9)22(30)34-20-16(26)18(28)21(35(31,32)33)19(29)17(20)27/h10-11H,1-9H3,(H,31,32,33)/p-1 |
| InChIKey | XNYYJQXTCJTFFA-UHFFFAOYSA-M |
| XLogP | 6.26 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.56 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|