C8H14O3 — CID 176604083
2-(1-ethenoxyethyl)-1,4-dioxane (PubChem CID 176604083) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is 2-(1-ethenoxyethyl)-1,4-dioxane.
| Compound Name | 2-(1-ethenoxyethyl)-1,4-dioxane |
|---|---|
| PubChem CID | 176604083 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 2-(1-ethenoxyethyl)-1,4-dioxane |
| SMILES | C=COC(C)C1COCCO1 |
| InChI | InChI=1S/C8H14O3/c1-3-10-7(2)8-6-9-4-5-11-8/h3,7-8H,1,4-6H2,2H3 |
| InChIKey | WPOIXNPHQWUHNM-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|