C42H51F4O6S- — CID 176604340
2,3,5,6-tetrafluoro-4-[[3-(2,4,6-tricyclohexylbenzoyl)oxy-1-adamantyl]methoxy]benzenesulfonate (PubChem CID 176604340) has the molecular formula C42H51F4O6S- and a molecular weight of 759.92 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[[3-(2,4,6-tricyclohexylbenzoyl)oxy-1-adamantyl]methoxy]benzenesulfonate.
| Compound Name | 2,3,5,6-tetrafluoro-4-[[3-(2,4,6-tricyclohexylbenzoyl)oxy-1-adamantyl]methoxy]benzenesulfonate |
|---|---|
| PubChem CID | 176604340 |
| Molecular Formula | C42H51F4O6S- |
| Molecular Weight | 759.92 g/mol |
| Exact Mass | 759.33 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[[3-(2,4,6-tricyclohexylbenzoyl)oxy-1-adamantyl]methoxy]benzenesulfonate |
| SMILES | O=C(OC12CC3CC(CC(COc4c(F)c(F)c(S(=O)(=O)[O-])c(F)c4F)(C3)C1)C2)c1c(C2CCCCC2)cc(C2CCCCC2)cc1C1CCCCC1 |
| InChI | InChI=1S/C42H52F4O6S/c43-34-36(45)39(53(48,49)50)37(46)35(44)38(34)51-24-41-19-25-16-26(20-41)22-42(21-25,23-41)52-40(47)33-31(28-12-6-2-7-13-28)17-30(27-10-4-1-5-11-27)18-32(33)29-14-8-3-9-15-29/h17-18,25-29H,1-16,19-24H2,(H,48,49,50)/p-1 |
| InChIKey | BTNUEKVYTZQPLN-UHFFFAOYSA-M |
| XLogP | 10.86 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.92 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|