C34H43F4O6S- — CID 140699215
4-[2,4-dicyclohexyl-6-[2-(3-ethyl-2-methylpentan-3-yl)oxy-2-oxoethyl]phenoxy]-2,3,5,6-tetrafluorobenzenesulfonate (PubChem CID 140699215) has the molecular formula C34H43F4O6S- and a molecular weight of 655.77 g/mol. Its IUPAC name is 4-[2,4-dicyclohexyl-6-[2-(3-ethyl-2-methylpentan-3-yl)oxy-2-oxoethyl]phenoxy]-2,3,5,6-tetrafluorobenzenesulfonate.
| Compound Name | 4-[2,4-dicyclohexyl-6-[2-(3-ethyl-2-methylpentan-3-yl)oxy-2-oxoethyl]phenoxy]-2,3,5,6-tetrafluorobenzenesulfonate |
|---|---|
| PubChem CID | 140699215 |
| Molecular Formula | C34H43F4O6S- |
| Molecular Weight | 655.77 g/mol |
| Exact Mass | 655.27 |
| IUPAC Name | 4-[2,4-dicyclohexyl-6-[2-(3-ethyl-2-methylpentan-3-yl)oxy-2-oxoethyl]phenoxy]-2,3,5,6-tetrafluorobenzenesulfonate |
| SMILES | CCC(CC)(OC(=O)Cc1cc(C2CCCCC2)cc(C2CCCCC2)c1Oc1c(F)c(F)c(S(=O)(=O)[O-])c(F)c1F)C(C)C |
| InChI | InChI=1S/C34H44F4O6S/c1-5-34(6-2,20(3)4)44-26(39)19-24-17-23(21-13-9-7-10-14-21)18-25(22-15-11-8-12-16-22)31(24)43-32-27(35)29(37)33(45(40,41)42)30(38)28(32)36/h17-18,20-22H,5-16,19H2,1-4H3,(H,40,41,42)/p-1 |
| InChIKey | FHVXMBFILVRYJN-UHFFFAOYSA-M |
| XLogP | 9.34 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.77 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|