C30H37F2O4S- — CID 140699170
2,6-difluoro-4-(2,4,6-tricyclohexylphenoxy)benzenesulfonate (PubChem CID 140699170) has the molecular formula C30H37F2O4S- and a molecular weight of 531.69 g/mol. Its IUPAC name is 2,6-difluoro-4-(2,4,6-tricyclohexylphenoxy)benzenesulfonate.
| Compound Name | 2,6-difluoro-4-(2,4,6-tricyclohexylphenoxy)benzenesulfonate |
|---|---|
| PubChem CID | 140699170 |
| Molecular Formula | C30H37F2O4S- |
| Molecular Weight | 531.69 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | 2,6-difluoro-4-(2,4,6-tricyclohexylphenoxy)benzenesulfonate |
| SMILES | O=S(=O)([O-])c1c(F)cc(Oc2c(C3CCCCC3)cc(C3CCCCC3)cc2C2CCCCC2)cc1F |
| InChI | InChI=1S/C30H38F2O4S/c31-27-18-24(19-28(32)30(27)37(33,34)35)36-29-25(21-12-6-2-7-13-21)16-23(20-10-4-1-5-11-20)17-26(29)22-14-8-3-9-15-22/h16-22H,1-15H2,(H,33,34,35)/p-1 |
| InChIKey | MVYQLUBFVLSCJQ-UHFFFAOYSA-M |
| XLogP | 8.80 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.69 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|