C24H16F4I3O7S- — CID 153471671
2,3,5,6-tetrafluoro-4-[3-(2,3,5-triiodobenzoyl)oxyadamantane-1-carbonyl]oxybenzenesulfonate (PubChem CID 153471671) has the molecular formula C24H16F4I3O7S- and a molecular weight of 905.16 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[3-(2,3,5-triiodobenzoyl)oxyadamantane-1-carbonyl]oxybenzenesulfonate.
| Compound Name | 2,3,5,6-tetrafluoro-4-[3-(2,3,5-triiodobenzoyl)oxyadamantane-1-carbonyl]oxybenzenesulfonate |
|---|---|
| PubChem CID | 153471671 |
| Molecular Formula | C24H16F4I3O7S- |
| Molecular Weight | 905.16 g/mol |
| Exact Mass | 904.77 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[3-(2,3,5-triiodobenzoyl)oxyadamantane-1-carbonyl]oxybenzenesulfonate |
| SMILES | O=C(OC12CC3CC(C1)CC(C(=O)Oc1c(F)c(F)c(S(=O)(=O)[O-])c(F)c1F)(C3)C2)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C24H17F4I3O7S/c25-14-16(27)20(39(34,35)36)17(28)15(26)19(14)37-22(33)23-4-9-1-10(5-23)7-24(6-9,8-23)38-21(32)12-2-11(29)3-13(30)18(12)31/h2-3,9-10H,1,4-8H2,(H,34,35,36)/p-1 |
| InChIKey | YTLAIABOJYKRDR-UHFFFAOYSA-M |
| XLogP | 6.06 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.16 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|