C17H10F2I3O7S- — CID 153471629
2,6-difluoro-4-[4-(2,3,5-triiodobenzoyl)oxybutanoyloxy]benzenesulfonate (PubChem CID 153471629) has the molecular formula C17H10F2I3O7S- and a molecular weight of 777.03 g/mol. Its IUPAC name is 2,6-difluoro-4-[4-(2,3,5-triiodobenzoyl)oxybutanoyloxy]benzenesulfonate.
| Compound Name | 2,6-difluoro-4-[4-(2,3,5-triiodobenzoyl)oxybutanoyloxy]benzenesulfonate |
|---|---|
| PubChem CID | 153471629 |
| Molecular Formula | C17H10F2I3O7S- |
| Molecular Weight | 777.03 g/mol |
| Exact Mass | 776.73 |
| IUPAC Name | 2,6-difluoro-4-[4-(2,3,5-triiodobenzoyl)oxybutanoyloxy]benzenesulfonate |
| SMILES | O=C(CCCOC(=O)c1cc(I)cc(I)c1I)Oc1cc(F)c(S(=O)(=O)[O-])c(F)c1 |
| InChI | InChI=1S/C17H11F2I3O7S/c18-11-6-9(7-12(19)16(11)30(25,26)27)29-14(23)2-1-3-28-17(24)10-4-8(20)5-13(21)15(10)22/h4-7H,1-3H2,(H,25,26,27)/p-1 |
| InChIKey | CVAUWIHQIRRENG-UHFFFAOYSA-M |
| XLogP | 4.23 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.03 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|