C20H14F4IO7S- — CID 153471567
4-[3-(cyclohexanecarbonyloxy)-4-iodobenzoyl]oxy-2,3,5,6-tetrafluorobenzenesulfonate (PubChem CID 153471567) has the molecular formula C20H14F4IO7S- and a molecular weight of 601.29 g/mol. Its IUPAC name is 4-[3-(cyclohexanecarbonyloxy)-4-iodobenzoyl]oxy-2,3,5,6-tetrafluorobenzenesulfonate.
| Compound Name | 4-[3-(cyclohexanecarbonyloxy)-4-iodobenzoyl]oxy-2,3,5,6-tetrafluorobenzenesulfonate |
|---|---|
| PubChem CID | 153471567 |
| Molecular Formula | C20H14F4IO7S- |
| Molecular Weight | 601.29 g/mol |
| Exact Mass | 600.94 |
| IUPAC Name | 4-[3-(cyclohexanecarbonyloxy)-4-iodobenzoyl]oxy-2,3,5,6-tetrafluorobenzenesulfonate |
| SMILES | O=C(Oc1c(F)c(F)c(S(=O)(=O)[O-])c(F)c1F)c1ccc(I)c(OC(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C20H15F4IO7S/c21-13-15(23)18(33(28,29)30)16(24)14(22)17(13)32-20(27)10-6-7-11(25)12(8-10)31-19(26)9-4-2-1-3-5-9/h6-9H,1-5H2,(H,28,29,30)/p-1 |
| InChIKey | BPOARXGTBDFWKC-UHFFFAOYSA-M |
| XLogP | 4.46 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.29 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|