C25H16F4I3O6- — CID 153467991
2,3,5,6-tetrafluoro-4-[3-(2,3,5-triiodobenzoyl)oxyadamantane-1-carbonyl]oxybenzoate (PubChem CID 153467991) has the molecular formula C25H16F4I3O6- and a molecular weight of 869.10 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[3-(2,3,5-triiodobenzoyl)oxyadamantane-1-carbonyl]oxybenzoate.
| Compound Name | 2,3,5,6-tetrafluoro-4-[3-(2,3,5-triiodobenzoyl)oxyadamantane-1-carbonyl]oxybenzoate |
|---|---|
| PubChem CID | 153467991 |
| Molecular Formula | C25H16F4I3O6- |
| Molecular Weight | 869.10 g/mol |
| Exact Mass | 868.80 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[3-(2,3,5-triiodobenzoyl)oxyadamantane-1-carbonyl]oxybenzoate |
| SMILES | O=C(OC12CC3CC(C1)CC(C(=O)Oc1c(F)c(F)c(C(=O)[O-])c(F)c1F)(C3)C2)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C25H17F4I3O6/c26-15-14(21(33)34)16(27)18(29)20(17(15)28)37-23(36)24-4-9-1-10(5-24)7-25(6-9,8-24)38-22(35)12-2-11(30)3-13(31)19(12)32/h2-3,9-10H,1,4-8H2,(H,33,34)/p-1 |
| InChIKey | KDKYVHWKOOQZAE-UHFFFAOYSA-M |
| XLogP | 5.52 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.10 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|