C38H75NO2Si2 — CID 176610509
N-[10,10-bis(prop-2-enyl)tridec-12-enyl]-11-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]undecanamide (PubChem CID 176610509) has the molecular formula C38H75NO2Si2 and a molecular weight of 634.19 g/mol. Its IUPAC name is N-[10,10-bis(prop-2-enyl)tridec-12-enyl]-11-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]undecanamide.
| Compound Name | N-[10,10-bis(prop-2-enyl)tridec-12-enyl]-11-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]undecanamide |
|---|---|
| PubChem CID | 176610509 |
| Molecular Formula | C38H75NO2Si2 |
| Molecular Weight | 634.19 g/mol |
| Exact Mass | 633.53 |
| IUPAC Name | N-[10,10-bis(prop-2-enyl)tridec-12-enyl]-11-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]undecanamide |
| SMILES | C=CCC(CC=C)(CC=C)CCCCCCCCCNC(=O)CCCCCCCCCC[Si](C)(C)O[Si](C)(C)CCCC |
| InChI | InChI=1S/C38H75NO2Si2/c1-9-13-35-42(5,6)41-43(7,8)36-28-24-20-15-14-17-21-25-29-37(40)39-34-27-23-19-16-18-22-26-33-38(30-10-2,31-11-3)32-12-4/h10-12H,2-4,9,13-36H2,1,5-8H3,(H,39,40) |
| InChIKey | IVEGBZXKAUILDO-UHFFFAOYSA-N |
| XLogP | 12.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.19 |
| LogP ≤ 5 | 12.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|