C15H25F3N2O3 — CID 176613625
3,5,5-tri(propan-2-yl)-1-[2-(trifluoromethoxy)ethyl]imidazolidine-2,4-dione (PubChem CID 176613625) has the molecular formula C15H25F3N2O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is 3,5,5-tri(propan-2-yl)-1-[2-(trifluoromethoxy)ethyl]imidazolidine-2,4-dione.
| Compound Name | 3,5,5-tri(propan-2-yl)-1-[2-(trifluoromethoxy)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 176613625 |
| Molecular Formula | C15H25F3N2O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 3,5,5-tri(propan-2-yl)-1-[2-(trifluoromethoxy)ethyl]imidazolidine-2,4-dione |
| SMILES | CC(C)N1C(=O)N(CCOC(F)(F)F)C(C(C)C)(C(C)C)C1=O |
| InChI | InChI=1S/C15H25F3N2O3/c1-9(2)14(10(3)4)12(21)20(11(5)6)13(22)19(14)7-8-23-15(16,17)18/h9-11H,7-8H2,1-6H3 |
| InChIKey | IMMVCDOBJOGODU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|