C14H24F2N2O2 — CID 176613659
1-(2,2-difluoroethyl)-3,5,5-tri(propan-2-yl)imidazolidine-2,4-dione (PubChem CID 176613659) has the molecular formula C14H24F2N2O2 and a molecular weight of 290.35 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3,5,5-tri(propan-2-yl)imidazolidine-2,4-dione.
| Compound Name | 1-(2,2-difluoroethyl)-3,5,5-tri(propan-2-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 176613659 |
| Molecular Formula | C14H24F2N2O2 |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3,5,5-tri(propan-2-yl)imidazolidine-2,4-dione |
| SMILES | CC(C)N1C(=O)N(CC(F)F)C(C(C)C)(C(C)C)C1=O |
| InChI | InChI=1S/C14H24F2N2O2/c1-8(2)14(9(3)4)12(19)18(10(5)6)13(20)17(14)7-11(15)16/h8-11H,7H2,1-6H3 |
| InChIKey | IEBZODFPVPKFLA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|