C11H17F3N2O3 — CID 97349675
(5S)-5-methyl-5-propan-2-yl-3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazolidine-2,4-dione (PubChem CID 97349675) has the molecular formula C11H17F3N2O3 and a molecular weight of 282.26 g/mol. Its IUPAC name is (5S)-5-methyl-5-propan-2-yl-3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-methyl-5-propan-2-yl-3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 97349675 |
| Molecular Formula | C11H17F3N2O3 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | (5S)-5-methyl-5-propan-2-yl-3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazolidine-2,4-dione |
| SMILES | CC(C)[C@]1(C)NC(=O)N(CCOCC(F)(F)F)C1=O |
| InChI | InChI=1S/C11H17F3N2O3/c1-7(2)10(3)8(17)16(9(18)15-10)4-5-19-6-11(12,13)14/h7H,4-6H2,1-3H3,(H,15,18)/t10-/m0/s1 |
| InChIKey | PCWCARPIHOHPOP-JTQLQIEISA-N |
| XLogP | 1.53 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|