C17H13FN4 — CID 176613772
5-(3-fluoro-4-isocyanophenyl)-1-(4-methylphenyl)pyrazol-3-amine (PubChem CID 176613772) has the molecular formula C17H13FN4 and a molecular weight of 292.32 g/mol. Its IUPAC name is 5-(3-fluoro-4-isocyanophenyl)-1-(4-methylphenyl)pyrazol-3-amine.
| Compound Name | 5-(3-fluoro-4-isocyanophenyl)-1-(4-methylphenyl)pyrazol-3-amine |
|---|---|
| PubChem CID | 176613772 |
| Molecular Formula | C17H13FN4 |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 5-(3-fluoro-4-isocyanophenyl)-1-(4-methylphenyl)pyrazol-3-amine |
| SMILES | [C-]#[N+]c1ccc(-c2cc(N)nn2-c2ccc(C)cc2)cc1F |
| InChI | InChI=1S/C17H13FN4/c1-11-3-6-13(7-4-11)22-16(10-17(19)21-22)12-5-8-15(20-2)14(18)9-12/h3-10H,1H3,(H2,19,21) |
| InChIKey | XECNHRFOOZMPIX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 48.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|