C13H16FN3O2 — CID 176615901
(1S,4S)-2-(2-fluoroethyl)-5-(4-nitrophenyl)-2,5-diazabicyclo[2.2.1]heptane (PubChem CID 176615901) has the molecular formula C13H16FN3O2 and a molecular weight of 265.29 g/mol. Its IUPAC name is (1S,4S)-2-(2-fluoroethyl)-5-(4-nitrophenyl)-2,5-diazabicyclo[2.2.1]heptane.
| Compound Name | (1S,4S)-2-(2-fluoroethyl)-5-(4-nitrophenyl)-2,5-diazabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 176615901 |
| Molecular Formula | C13H16FN3O2 |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | (1S,4S)-2-(2-fluoroethyl)-5-(4-nitrophenyl)-2,5-diazabicyclo[2.2.1]heptane |
| SMILES | O=[N+]([O-])c1ccc(N2C[C@@H]3C[C@H]2CN3CCF)cc1 |
| InChI | InChI=1S/C13H16FN3O2/c14-5-6-15-8-13-7-12(15)9-16(13)10-1-3-11(4-2-10)17(18)19/h1-4,12-13H,5-9H2/t12-,13-/m0/s1 |
| InChIKey | YAPXJAZWFLYQLW-STQMWFEESA-N |
| XLogP | 1.83 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|