About CID 176620576
CID 176620576 (PubChem CID 176620576) has the molecular formula C6H10O4S
and a molecular weight of 178.21 g/mol.
Molecular Properties
| Compound Name | CID 176620576 |
| PubChem CID | 176620576 |
| Molecular Formula | C6H10O4S |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | — |
| SMILES | CC(=O)S(O)(C(C)=O)C(C)=O |
| InChI | InChI=1S/C6H10O4S/c1-4(7)11(10,5(2)8)6(3)9/h10H,1-3H3 |
| InChIKey | LTXMXXRVGGGFOL-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze CID 176620576 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176620576?
The IUPAC name of CID 176620576 (CID 176620576) is not available.
What is the SMILES notation for CID 176620576?
The canonical SMILES for CID 176620576 is CC(=O)S(O)(C(C)=O)C(C)=O.
What is the InChIKey of CID 176620576?
The InChIKey is LTXMXXRVGGGFOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O4S/c1-4(7)11(10,5(2)8)6(3)9/h10H,1-3H3.
What are the key properties of CID 176620576?
CID 176620576 has a molecular weight of 178.21 g/mol, XLogP of 0.90, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176620576 is sourced from PubChem (CID 176620576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).