About cobalt;copper(1+);acetate
cobalt;copper(1+);acetate (PubChem CID 174928314) has the molecular formula C2H3CoCuO2
and a molecular weight of 181.52 g/mol. Its IUPAC name is cobalt;copper(1+);acetate.
Molecular Properties
| Compound Name | cobalt;copper(1+);acetate |
| PubChem CID | 174928314 |
| Molecular Formula | C2H3CoCuO2 |
| Molecular Weight | 181.52 g/mol |
| Exact Mass | 180.88 |
| IUPAC Name | cobalt;copper(1+);acetate |
| SMILES | CC(=O)[O-].[Co].[Cu+] |
| InChI | InChI=1S/C2H4O2.Co.Cu/c1-2(3)4;;/h1H3,(H,3,4);;/q;;+1/p-1 |
| InChIKey | QMDUBCSJXHOIFY-UHFFFAOYSA-M |
| XLogP | -1.25 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.52 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cobalt;copper(1+);acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;copper(1+);acetate?
The IUPAC name of cobalt;copper(1+);acetate (CID 174928314) is cobalt;copper(1+);acetate.
What is the SMILES notation for cobalt;copper(1+);acetate?
The canonical SMILES for cobalt;copper(1+);acetate is CC(=O)[O-].[Co].[Cu+].
What is the InChIKey of cobalt;copper(1+);acetate?
The InChIKey is QMDUBCSJXHOIFY-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4O2.Co.Cu/c1-2(3)4;;/h1H3,(H,3,4);;/q;;+1/p-1.
What are the key properties of cobalt;copper(1+);acetate?
cobalt;copper(1+);acetate has a molecular weight of 181.52 g/mol, XLogP of -1.25, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;copper(1+);acetate is sourced from PubChem (CID 174928314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).