About copper(1+);acetate;hydroiodide
copper(1+);acetate;hydroiodide (PubChem CID 175324821) has the molecular formula C2H4CuIO2
and a molecular weight of 250.50 g/mol. Its IUPAC name is copper(1+);acetate;hydroiodide.
Molecular Properties
| Compound Name | copper(1+);acetate;hydroiodide |
| PubChem CID | 175324821 |
| Molecular Formula | C2H4CuIO2 |
| Molecular Weight | 250.50 g/mol |
| Exact Mass | 249.86 |
| IUPAC Name | copper(1+);acetate;hydroiodide |
| SMILES | CC(=O)[O-].I.[Cu+] |
| InChI | InChI=1S/C2H4O2.Cu.HI/c1-2(3)4;;/h1H3,(H,3,4);;1H/q;+1;/p-1 |
| InChIKey | YYVYDUDXXWMDLD-UHFFFAOYSA-M |
| XLogP | -0.63 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.50 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze copper(1+);acetate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper(1+);acetate;hydroiodide?
The IUPAC name of copper(1+);acetate;hydroiodide (CID 175324821) is copper(1+);acetate;hydroiodide.
What is the SMILES notation for copper(1+);acetate;hydroiodide?
The canonical SMILES for copper(1+);acetate;hydroiodide is CC(=O)[O-].I.[Cu+].
What is the InChIKey of copper(1+);acetate;hydroiodide?
The InChIKey is YYVYDUDXXWMDLD-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4O2.Cu.HI/c1-2(3)4;;/h1H3,(H,3,4);;1H/q;+1;/p-1.
What are the key properties of copper(1+);acetate;hydroiodide?
copper(1+);acetate;hydroiodide has a molecular weight of 250.50 g/mol, XLogP of -0.63, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper(1+);acetate;hydroiodide is sourced from PubChem (CID 175324821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).