About thallium(1+);acetate;hydroiodide
thallium(1+);acetate;hydroiodide (PubChem CID 22996234) has the molecular formula C2H4IO2Tl
and a molecular weight of 391.34 g/mol. Its IUPAC name is thallium(1+);acetate;hydroiodide.
Molecular Properties
| Compound Name | thallium(1+);acetate;hydroiodide |
| PubChem CID | 22996234 |
| Molecular Formula | C2H4IO2Tl |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 391.90 |
| IUPAC Name | thallium(1+);acetate;hydroiodide |
| SMILES | CC(=O)[O-].I.[Tl+] |
| InChI | InChI=1S/C2H4O2.HI.Tl/c1-2(3)4;;/h1H3,(H,3,4);1H;/q;;+1/p-1 |
| InChIKey | SSWGYYZQKKSMAE-UHFFFAOYSA-M |
| XLogP | -1.01 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze thallium(1+);acetate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thallium(1+);acetate;hydroiodide?
The IUPAC name of thallium(1+);acetate;hydroiodide (CID 22996234) is thallium(1+);acetate;hydroiodide.
What is the SMILES notation for thallium(1+);acetate;hydroiodide?
The canonical SMILES for thallium(1+);acetate;hydroiodide is CC(=O)[O-].I.[Tl+].
What is the InChIKey of thallium(1+);acetate;hydroiodide?
The InChIKey is SSWGYYZQKKSMAE-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4O2.HI.Tl/c1-2(3)4;;/h1H3,(H,3,4);1H;/q;;+1/p-1.
What are the key properties of thallium(1+);acetate;hydroiodide?
thallium(1+);acetate;hydroiodide has a molecular weight of 391.34 g/mol, XLogP of -1.01, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for thallium(1+);acetate;hydroiodide is sourced from PubChem (CID 22996234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).