C33H23F3N2O10 — CID 176621293
[(3R,3aR,6S,6aR)-6-[2-[3-methyl-5-(trifluoromethyl)phenyl]-1,3-dioxoisoindole-5-carbonyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 2-methyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 176621293) has the molecular formula C33H23F3N2O10 and a molecular weight of 664.55 g/mol. Its IUPAC name is [(3R,3aR,6S,6aR)-6-[2-[3-methyl-5-(trifluoromethyl)phenyl]-1,3-dioxoisoindole-5-carbonyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 2-methyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [(3R,3aR,6S,6aR)-6-[2-[3-methyl-5-(trifluoromethyl)phenyl]-1,3-dioxoisoindole-5-carbonyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 2-methyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 176621293 |
| Molecular Formula | C33H23F3N2O10 |
| Molecular Weight | 664.55 g/mol |
| Exact Mass | 664.13 |
| IUPAC Name | [(3R,3aR,6S,6aR)-6-[2-[3-methyl-5-(trifluoromethyl)phenyl]-1,3-dioxoisoindole-5-carbonyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 2-methyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1cc(N2C(=O)c3ccc(C(=O)O[C@H]4CO[C@H]5[C@@H]4OC[C@H]5OC(=O)c4ccc5c(c4)C(=O)N(C)C5=O)cc3C2=O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C33H23F3N2O10/c1-14-7-17(33(34,35)36)11-18(8-14)38-29(41)20-6-4-16(10-22(20)30(38)42)32(44)48-24-13-46-25-23(12-45-26(24)25)47-31(43)15-3-5-19-21(9-15)28(40)37(2)27(19)39/h3-11,23-26H,12-13H2,1-2H3/t23-,24+,25-,26-/m1/s1 |
| InChIKey | SZVUYJGXSJLLCN-XDZVQPMWSA-N |
| XLogP | 3.59 |
| TPSA | 145.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.55 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|