C27H50O5S — CID 176622285
2-oxononan-4-yl 7-[(3R,4S,5S,6R)-6-ethyl-3,4,5-trimethyloxan-2-yl]sulfanyl-3-methoxyheptanoate (PubChem CID 176622285) has the molecular formula C27H50O5S and a molecular weight of 486.76 g/mol. Its IUPAC name is 2-oxononan-4-yl 7-[(3R,4S,5S,6R)-6-ethyl-3,4,5-trimethyloxan-2-yl]sulfanyl-3-methoxyheptanoate.
| Compound Name | 2-oxononan-4-yl 7-[(3R,4S,5S,6R)-6-ethyl-3,4,5-trimethyloxan-2-yl]sulfanyl-3-methoxyheptanoate |
|---|---|
| PubChem CID | 176622285 |
| Molecular Formula | C27H50O5S |
| Molecular Weight | 486.76 g/mol |
| Exact Mass | 486.34 |
| IUPAC Name | 2-oxononan-4-yl 7-[(3R,4S,5S,6R)-6-ethyl-3,4,5-trimethyloxan-2-yl]sulfanyl-3-methoxyheptanoate |
| SMILES | CCCCCC(CC(C)=O)OC(=O)CC(CCCCSC1O[C@H](CC)[C@@H](C)[C@H](C)[C@H]1C)OC |
| InChI | InChI=1S/C27H50O5S/c1-8-10-11-15-24(17-19(3)28)31-26(29)18-23(30-7)14-12-13-16-33-27-22(6)20(4)21(5)25(9-2)32-27/h20-25,27H,8-18H2,1-7H3/t20-,21-,22+,23?,24?,25+,27?/m0/s1 |
| InChIKey | BNXRKYIKKGUINM-QDHKTHBBSA-N |
| XLogP | 6.81 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.76 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|