C16H20N4O3 — CID 176628918
tert-butyl N-[(11S)-9-methyl-10-oxo-1,7,9-triazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-11-yl]carbamate (PubChem CID 176628918) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is tert-butyl N-[(11S)-9-methyl-10-oxo-1,7,9-triazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-11-yl]carbamate.
| Compound Name | tert-butyl N-[(11S)-9-methyl-10-oxo-1,7,9-triazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-11-yl]carbamate |
|---|---|
| PubChem CID | 176628918 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | tert-butyl N-[(11S)-9-methyl-10-oxo-1,7,9-triazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-11-yl]carbamate |
| SMILES | CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)Cn2ccc3ccnc1c32 |
| InChI | InChI=1S/C16H20N4O3/c1-16(2,3)23-15(22)18-11-9-20-8-6-10-5-7-17-13(12(10)20)19(4)14(11)21/h5-8,11H,9H2,1-4H3,(H,18,22)/t11-/m0/s1 |
| InChIKey | RTQNLDMIAIUFAA-NSHDSACASA-N |
| XLogP | 1.91 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |