C16H23NO7 — CID 176636436
tert-butyl 1-(2,2-dimethyl-4,6-dioxo-1,3-dioxane-5-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 176636436) has the molecular formula C16H23NO7 and a molecular weight of 341.36 g/mol. Its IUPAC name is tert-butyl 1-(2,2-dimethyl-4,6-dioxo-1,3-dioxane-5-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl 1-(2,2-dimethyl-4,6-dioxo-1,3-dioxane-5-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 176636436 |
| Molecular Formula | C16H23NO7 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | tert-butyl 1-(2,2-dimethyl-4,6-dioxo-1,3-dioxane-5-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CCCN1C(=O)C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C16H23NO7/c1-15(2,3)22-12(19)9-7-6-8-17(9)11(18)10-13(20)23-16(4,5)24-14(10)21/h9-10H,6-8H2,1-5H3 |
| InChIKey | BHAQAGQDDDHAOI-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|