C24H23N3O4 — CID 176640104
(10S)-19-amino-10-ethyl-10-hydroxy-23-methyl-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16(24),17,19-heptaene-5,9-dione (PubChem CID 176640104) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is (10S)-19-amino-10-ethyl-10-hydroxy-23-methyl-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16(24),17,19-heptaene-5,9-dione.
| Compound Name | (10S)-19-amino-10-ethyl-10-hydroxy-23-methyl-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16(24),17,19-heptaene-5,9-dione |
|---|---|
| PubChem CID | 176640104 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | (10S)-19-amino-10-ethyl-10-hydroxy-23-methyl-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16(24),17,19-heptaene-5,9-dione |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1ccc(N)c3c1c2C(C)CC3 |
| InChI | InChI=1S/C24H23N3O4/c1-3-24(30)15-8-18-21-13(9-27(18)22(28)14(15)10-31-23(24)29)19-11(2)4-5-12-16(25)6-7-17(26-21)20(12)19/h6-8,11,30H,3-5,9-10,25H2,1-2H3/t11?,24-/m0/s1 |
| InChIKey | KEHAEMGHLDLETB-VBMJKRJRSA-N |
| XLogP | 2.71 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|