C12H19NS — CID 176640371
3,5-di(propan-2-yl)-4,6-dihydrothieno[3,4-c]pyrrole (PubChem CID 176640371) has the molecular formula C12H19NS and a molecular weight of 209.36 g/mol. Its IUPAC name is 3,5-di(propan-2-yl)-4,6-dihydrothieno[3,4-c]pyrrole.
| Compound Name | 3,5-di(propan-2-yl)-4,6-dihydrothieno[3,4-c]pyrrole |
|---|---|
| PubChem CID | 176640371 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 3,5-di(propan-2-yl)-4,6-dihydrothieno[3,4-c]pyrrole |
| SMILES | CC(C)c1scc2c1CN(C(C)C)C2 |
| InChI | InChI=1S/C12H19NS/c1-8(2)12-11-6-13(9(3)4)5-10(11)7-14-12/h7-9H,5-6H2,1-4H3 |
| InChIKey | DPNKMPABBPQESA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |