C36H47N7O5 — CID 176644585
3-[(1S)-1-cyclohexyl-2-[4-[(2R)-3-[4-[(3-hydroxyphenyl)methyl]piperazin-1-yl]-3-oxo-2-(propanoylamino)propyl]anilino]-2-oxoethyl]-1-methylpyrazole-5-carboxamide (PubChem CID 176644585) has the molecular formula C36H47N7O5 and a molecular weight of 657.82 g/mol. Its IUPAC name is 3-[(1S)-1-cyclohexyl-2-[4-[(2R)-3-[4-[(3-hydroxyphenyl)methyl]piperazin-1-yl]-3-oxo-2-(propanoylamino)propyl]anilino]-2-oxoethyl]-1-methylpyrazole-5-carboxamide.
| Compound Name | 3-[(1S)-1-cyclohexyl-2-[4-[(2R)-3-[4-[(3-hydroxyphenyl)methyl]piperazin-1-yl]-3-oxo-2-(propanoylamino)propyl]anilino]-2-oxoethyl]-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 176644585 |
| Molecular Formula | C36H47N7O5 |
| Molecular Weight | 657.82 g/mol |
| Exact Mass | 657.36 |
| IUPAC Name | 3-[(1S)-1-cyclohexyl-2-[4-[(2R)-3-[4-[(3-hydroxyphenyl)methyl]piperazin-1-yl]-3-oxo-2-(propanoylamino)propyl]anilino]-2-oxoethyl]-1-methylpyrazole-5-carboxamide |
| SMILES | CCC(=O)N[C@H](Cc1ccc(NC(=O)[C@H](c2cc(C(N)=O)n(C)n2)C2CCCCC2)cc1)C(=O)N1CCN(Cc2cccc(O)c2)CC1 |
| InChI | InChI=1S/C36H47N7O5/c1-3-32(45)39-30(36(48)43-18-16-42(17-19-43)23-25-8-7-11-28(44)20-25)21-24-12-14-27(15-13-24)38-35(47)33(26-9-5-4-6-10-26)29-22-31(34(37)46)41(2)40-29/h7-8,11-15,20,22,26,30,33,44H,3-6,9-10,16-19,21,23H2,1-2H3,(H2,37,46)(H,38,47)(H,39,45)/t30-,33+/m1/s1 |
| InChIKey | BXFXUMNEQQTSHR-NDKRRWIDSA-N |
| XLogP | 3.31 |
| TPSA | 162.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.82 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |