C17H21ClN4O4S — CID 176644653
(E,2E)-2-(aminomethylidene)-N-[3-chloro-5-(methanesulfonamido)phenyl]-4-(2-oxopiperidin-1-yl)but-3-enamide (PubChem CID 176644653) has the molecular formula C17H21ClN4O4S and a molecular weight of 412.90 g/mol. Its IUPAC name is (E,2E)-2-(aminomethylidene)-N-[3-chloro-5-(methanesulfonamido)phenyl]-4-(2-oxopiperidin-1-yl)but-3-enamide.
| Compound Name | (E,2E)-2-(aminomethylidene)-N-[3-chloro-5-(methanesulfonamido)phenyl]-4-(2-oxopiperidin-1-yl)but-3-enamide |
|---|---|
| PubChem CID | 176644653 |
| Molecular Formula | C17H21ClN4O4S |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | (E,2E)-2-(aminomethylidene)-N-[3-chloro-5-(methanesulfonamido)phenyl]-4-(2-oxopiperidin-1-yl)but-3-enamide |
| SMILES | CS(=O)(=O)Nc1cc(Cl)cc(NC(=O)C(/C=C/N2CCCCC2=O)=C/N)c1 |
| InChI | InChI=1S/C17H21ClN4O4S/c1-27(25,26)21-15-9-13(18)8-14(10-15)20-17(24)12(11-19)5-7-22-6-3-2-4-16(22)23/h5,7-11,21H,2-4,6,19H2,1H3,(H,20,24)/b7-5+,12-11+ |
| InChIKey | DJZHWKFDHRBBMA-MCZQWLMRSA-N |
| XLogP | 2.02 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|