C16H22ClN5O3S — CID 172540621
(E)-3-amino-N-[3-chloro-5-(methanesulfonamido)phenyl]-2-(piperidin-4-yliminomethyl)prop-2-enamide (PubChem CID 172540621) has the molecular formula C16H22ClN5O3S and a molecular weight of 399.90 g/mol. Its IUPAC name is (E)-3-amino-N-[3-chloro-5-(methanesulfonamido)phenyl]-2-(piperidin-4-yliminomethyl)prop-2-enamide.
| Compound Name | (E)-3-amino-N-[3-chloro-5-(methanesulfonamido)phenyl]-2-(piperidin-4-yliminomethyl)prop-2-enamide |
|---|---|
| PubChem CID | 172540621 |
| Molecular Formula | C16H22ClN5O3S |
| Molecular Weight | 399.90 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | (E)-3-amino-N-[3-chloro-5-(methanesulfonamido)phenyl]-2-(piperidin-4-yliminomethyl)prop-2-enamide |
| SMILES | CS(=O)(=O)Nc1cc(Cl)cc(NC(=O)C(/C=N/C2CCNCC2)=C/N)c1 |
| InChI | InChI=1S/C16H22ClN5O3S/c1-26(24,25)22-15-7-12(17)6-14(8-15)21-16(23)11(9-18)10-20-13-2-4-19-5-3-13/h6-10,13,19,22H,2-5,18H2,1H3,(H,21,23)/b11-9+,20-10+ |
| InChIKey | XVQPYKRTTPGSMF-CQTMHWHQSA-N |
| XLogP | 1.32 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.90 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|