C12H15Cl2N3O2 — CID 118767524
1-(3,5-dichlorophenyl)-3-[(3R,4R)-4-hydroxypiperidin-3-yl]urea (PubChem CID 118767524) has the molecular formula C12H15Cl2N3O2 and a molecular weight of 304.18 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-[(3R,4R)-4-hydroxypiperidin-3-yl]urea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-[(3R,4R)-4-hydroxypiperidin-3-yl]urea |
|---|---|
| PubChem CID | 118767524 |
| Molecular Formula | C12H15Cl2N3O2 |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-[(3R,4R)-4-hydroxypiperidin-3-yl]urea |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)N[C@@H]1CNCC[C@H]1O |
| InChI | InChI=1S/C12H15Cl2N3O2/c13-7-3-8(14)5-9(4-7)16-12(19)17-10-6-15-2-1-11(10)18/h3-5,10-11,15,18H,1-2,6H2,(H2,16,17,19)/t10-,11-/m1/s1 |
| InChIKey | ASXVFZRJMKGCKQ-GHMZBOCLSA-N |
| XLogP | 1.84 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |