About 1,4-diazonane;bis(trimethylalumane)
1,4-diazonane;bis(trimethylalumane) (PubChem CID 176646607) has the molecular formula C13H34Al2N2
and a molecular weight of 272.39 g/mol. Its IUPAC name is 1,4-diazonane;bis(trimethylalumane).
Molecular Properties
| Compound Name | 1,4-diazonane;bis(trimethylalumane) |
| PubChem CID | 176646607 |
| Molecular Formula | C13H34Al2N2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.24 |
| IUPAC Name | 1,4-diazonane;bis(trimethylalumane) |
| SMILES | C1CCNCCNCC1.C[Al](C)C.C[Al](C)C |
| InChI | InChI=1S/C7H16N2.6CH3.2Al/c1-2-4-8-6-7-9-5-3-1;;;;;;;;/h8-9H,1-7H2;6*1H3;; |
| InChIKey | JJOLSKGDMVGOGD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-diazonane;bis(trimethylalumane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diazonane;bis(trimethylalumane)?
The IUPAC name of 1,4-diazonane;bis(trimethylalumane) (CID 176646607) is 1,4-diazonane;bis(trimethylalumane).
What is the SMILES notation for 1,4-diazonane;bis(trimethylalumane)?
The canonical SMILES for 1,4-diazonane;bis(trimethylalumane) is C1CCNCCNCC1.C[Al](C)C.C[Al](C)C.
What is the InChIKey of 1,4-diazonane;bis(trimethylalumane)?
The InChIKey is JJOLSKGDMVGOGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2.6CH3.2Al/c1-2-4-8-6-7-9-5-3-1;;;;;;;;/h8-9H,1-7H2;6*1H3;;.
What are the key properties of 1,4-diazonane;bis(trimethylalumane)?
1,4-diazonane;bis(trimethylalumane) has a molecular weight of 272.39 g/mol, XLogP of 3.09, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diazonane;bis(trimethylalumane) is sourced from PubChem (CID 176646607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).